tert-butyl 4-[2-hydroxy-2-(4-methoxyphenyl)ethyl]piperazine-1-carboxylate structure
|
Common Name | tert-butyl 4-[2-hydroxy-2-(4-methoxyphenyl)ethyl]piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 904815-65-2 | Molecular Weight | 336.42600 | |
| Density | 1.135g/cm3 | Boiling Point | 469.3ºC at 760 mmHg | |
| Molecular Formula | C18H28N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.6ºC | |
| Name | tert-butyl 4-[2-hydroxy-2-(4-methoxyphenyl)ethyl]piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 469.3ºC at 760 mmHg |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.42600 |
| Flash Point | 237.6ºC |
| Exact Mass | 336.20500 |
| PSA | 62.24000 |
| LogP | 2.15710 |
| Index of Refraction | 1.536 |
| InChIKey | GACSXPSYHLPYQG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)CN2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| GL-0255 |
| 4-[2-Hydroxy-2-(4-methoxy-phenyl)-ethyl]-piperazine-1-carboxylic acid tert-butyl ester |