tert-butyl 2-phenyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-5-carboxylate
Modify Date: 2025-08-29 12:43:00
tert-butyl 2-phenyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-5-carboxylate structure
|
Common Name | tert-butyl 2-phenyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 904815-39-0 | Molecular Weight | 324.41700 | |
| Density | 1.109g/cm3 | Boiling Point | 461.4ºC at 760mmHg | |
| Molecular Formula | C20H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.8ºC | |
| Name | tert-butyl 2-phenyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 461.4ºC at 760mmHg |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.41700 |
| Flash Point | 232.8ºC |
| Exact Mass | 324.18400 |
| PSA | 41.57000 |
| LogP | 5.18800 |
| Index of Refraction | 1.56 |
| InChIKey | IDLLPNGJRDBQAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccccc2)Nc2ccccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Phenyl-2,3,4,5-tetrahydro-benzo[b][1,4]diazepine-1-carboxylic acid tert-butyl ester |
| GL-0245 |