4-(4-nitrophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine structure
|
Common Name | 4-(4-nitrophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine | ||
|---|---|---|---|---|
| CAS Number | 904813-76-9 | Molecular Weight | 269.29900 | |
| Density | 1.212g/cm3 | Boiling Point | 485.9ºC at 760mmHg | |
| Molecular Formula | C15H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.7ºC | |
| Name | 4-(4-nitrophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 485.9ºC at 760mmHg |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.29900 |
| Flash Point | 247.7ºC |
| Exact Mass | 269.11600 |
| PSA | 69.88000 |
| LogP | 4.36280 |
| Index of Refraction | 1.601 |
| InChIKey | BCMPGVGSPVNQHE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C2CCNc3ccccc3N2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| gl-0138 |