3-bromo-2-tert-butyl-6-chloroimidazo[1,2-a]pyridine
Modify Date: 2024-04-05 14:22:40
![3-bromo-2-tert-butyl-6-chloroimidazo[1,2-a]pyridine Structure](https://image.chemsrc.com/caspic/418/904813-68-9.png)
3-bromo-2-tert-butyl-6-chloroimidazo[1,2-a]pyridine structure
|
Common Name | 3-bromo-2-tert-butyl-6-chloroimidazo[1,2-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 904813-68-9 | Molecular Weight | 287.58300 | |
| Density | 1.49g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H12BrClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromo-2-tert-butyl-6-chloroimidazo[1,2-a]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Molecular Formula | C11H12BrClN2 |
| Molecular Weight | 287.58300 |
| Exact Mass | 285.98700 |
| PSA | 17.30000 |
| LogP | 4.04770 |
| Index of Refraction | 1.615 |
| InChIKey | YNUPSOWFETTWCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1nc2ccc(Cl)cn2c1Br |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| gl-0397 |