3-(4-bromophenyl)sulfonyl-1-phenylpyrrolidine-2,5-dione
Modify Date: 2025-09-26 16:41:50
3-(4-bromophenyl)sulfonyl-1-phenylpyrrolidine-2,5-dione structure
|
Common Name | 3-(4-bromophenyl)sulfonyl-1-phenylpyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 90455-57-5 | Molecular Weight | 394.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12BrNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-bromophenyl)sulfonyl-1-phenylpyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12BrNO4S |
|---|---|
| Molecular Weight | 394.24000 |
| Exact Mass | 392.96700 |
| PSA | 79.90000 |
| LogP | 3.70070 |
| InChIKey | FOQVDMBQFXGOAJ-UHFFFAOYSA-N |
| SMILES | O=C1CC(S(=O)(=O)c2ccc(Br)cc2)C(=O)N1c1ccccc1 |
|
~%
3-(4-bromopheny... CAS#:90455-57-5 |
| Literature: Matsuda; Akiyama; Furuta; Mizuta Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 1 p. 219 - 221 |
| 2,5-Pyrrolidinedione,3-[(4-bromophenyl)sulfonyl]-1-phenyl |