chembrdg-bb 5527337
Modify Date: 2025-08-28 18:35:33
chembrdg-bb 5527337 structure
|
Common Name | chembrdg-bb 5527337 | ||
|---|---|---|---|---|
| CAS Number | 90390-05-9 | Molecular Weight | 194.23000 | |
| Density | 1.101g/cm3 | Boiling Point | 297.8ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.9ºC | |
| Name | chembrdg-bb 5527337 |
|---|
| Density | 1.101g/cm3 |
|---|---|
| Boiling Point | 297.8ºC at 760 mmHg |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23000 |
| Flash Point | 133.9ºC |
| Exact Mass | 194.10600 |
| PSA | 57.85000 |
| LogP | 3.00690 |
| Index of Refraction | 1.538 |
| InChIKey | WKELDPMQVANRBL-UHFFFAOYSA-N |
| SMILES | CC(C)NCc1cccc([N+](=O)[O-])c1 |
|
~%
chembrdg-bb 5527337 CAS#:90390-05-9 |
| Literature: Meindl; Von Angerer; Schonenberger; Ruckdeschel Journal of Medicinal Chemistry, 1984 , vol. 27, # 9 p. 1111 - 1118 |
|
~%
chembrdg-bb 5527337 CAS#:90390-05-9 |
| Literature: Meindl; Von Angerer; Schonenberger; Ruckdeschel Journal of Medicinal Chemistry, 1984 , vol. 27, # 9 p. 1111 - 1118 |
![N-[(3-Nitrophenyl)methylene]-2-propanamine structure](https://image.chemsrc.com/caspic/016/27895-80-3.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |