3-Amino-N-cyclohexyl-2-methylbenzamide
Modify Date: 2025-11-06 18:41:23
3-Amino-N-cyclohexyl-2-methylbenzamide structure
|
Common Name | 3-Amino-N-cyclohexyl-2-methylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 903843-12-9 | Molecular Weight | 232.32100 | |
| Density | 1.102g/cm3 | Boiling Point | 397.011ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.906ºC | |
| Name | 3-Amino-N-cyclohexyl-2-methylbenzamide |
|---|
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 397.011ºC at 760 mmHg |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.32100 |
| Flash Point | 193.906ºC |
| Exact Mass | 232.15800 |
| PSA | 58.61000 |
| LogP | 3.79570 |
| Index of Refraction | 1.569 |
| InChIKey | CWCLPHOIZSZWDE-UHFFFAOYSA-N |
| SMILES | Cc1c(N)cccc1C(=O)NC1CCCCC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |