(d(CH2)51,D-Tyr(Et)2,Val4,Arg8,des-Gly9)-Vasopressin structure
|
Common Name | (d(CH2)51,D-Tyr(Et)2,Val4,Arg8,des-Gly9)-Vasopressin | ||
|---|---|---|---|---|
| CAS Number | 90332-82-4 | Molecular Weight | 1079.34000 | |
| Density | 1.43g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C51H74N12O10S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (d(CH2)51,D-Tyr(Et)2,Val4,Arg8,des-Gly9)-Vasopressin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Molecular Formula | C51H74N12O10S2 |
| Molecular Weight | 1079.34000 |
| Exact Mass | 1078.51000 |
| PSA | 402.82000 |
| LogP | 5.10260 |
| Index of Refraction | 1.675 |
| InChIKey | DRLYXDZRLDZVIS-XXNQTUAPSA-N |
| SMILES | CCOc1ccc(CC2NC(=O)CC3(CCCCC3)SSCC(C(=O)N3CCCC3C(=O)NC(CCCN=C(N)N)C(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(C(C)C)NC(=O)C(Cc3ccccc3)NC2=O)cc1 |
|
~%
(d(CH2)51,D-Tyr... CAS#:90332-82-4 |
| Literature: Ali; Bryan; Chang; Huffman; Moore; Heckman; Kinter; McDonald; Schmidt; Shue Journal of Medicinal Chemistry, 1986 , vol. 29, # 6 p. 984 - 988 |
| Des-Gly9,d(CH2)5[D-Tyr(Et)2,Val4]arginine vasopressin |
| [d(CH2)5,D-Tyr(Et)2,Val4,des-Gly9]AVP |
| (D(CH2)(5/1),D-TYR(ET)2,VAL4,ARG8,DES-GLY9)-VASOPRESSIN |
| desGlyd(CH2)5<D-Tyr(Et)5>VAVP |
| O-Ethyl-N-[1-mercapto(1)cyclohexylacetyl]-D-Tyr-L-Phe-L-Val-L-Asn-L-Cys(1)-L-Pro-L-Arg-NH2 |
| b-Mercapto-b,b-cyclopentaMethylene-propionyl-D-Tyr(Et)-Phe-Val-Asn-Cys-Pro-Arg-NH2 |
| <Pmp1,D-Tyr(Et)2,Val4,desGly9>arginine-vasopressin |
| N-[[1-Mercapto(1)-cyclohexyl]acetyl]-O-ethyl-D-Tyr-L-Phe-L-Val-L-Asn-L-Cys(1)-L-Pro-L-Arg-NH2 |