4-(3-Chlorophenyl)tetrahydropyran-4-carboxaldehyde structure
|
Common Name | 4-(3-Chlorophenyl)tetrahydropyran-4-carboxaldehyde | ||
|---|---|---|---|---|
| CAS Number | 902836-60-6 | Molecular Weight | 224.68300 | |
| Density | 1.257g/cm3 | Boiling Point | 341.9ºC at 760mmHg | |
| Molecular Formula | C12H13ClO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 143ºC | |
| Name | 4-(3-chlorophenyl)oxane-4-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 341.9ºC at 760mmHg |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.68300 |
| Flash Point | 143ºC |
| Exact Mass | 224.06000 |
| PSA | 26.30000 |
| LogP | 2.58710 |
| Index of Refraction | 1.592 |
| InChIKey | DGVXFYWXCMGXSF-UHFFFAOYSA-N |
| SMILES | O=CC1(c2cccc(Cl)c2)CCOCC1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(3-Chlorophenyl)tetrahydro-2H-pyran-4-carboxaldehyde |
| MFCD08061010 |