(4S,7S)-7-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylic acid structure
|
Common Name | (4S,7S)-7-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 90139-06-3 | Molecular Weight | 389.44500 | |
| Density | 1.34g/cm3 | Boiling Point | 618.9ºC at 760mmHg | |
| Molecular Formula | C20H27N3O5 | Melting Point | 150-160ºC | |
| MSDS | N/A | Flash Point | 328.1ºC | |
| Name | (4S,7S)-7-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 618.9ºC at 760mmHg |
| Melting Point | 150-160ºC |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.44500 |
| Flash Point | 328.1ºC |
| Exact Mass | 389.19500 |
| PSA | 110.18000 |
| LogP | 1.38370 |
| Index of Refraction | 1.624 |
| InChIKey | UVAUYSRYXACKSC-ULQDDVLXSA-N |
| SMILES | O=C(O)C(CCc1ccccc1)NC1CCCN2CCCC(C(=O)O)N2C1=O |
|
~%
(4S,7S)-7-[[(1S... CAS#:90139-06-3 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 76, # 3 p. 224 - 227 |
|
~%
(4S,7S)-7-[[(1S... CAS#:90139-06-3 |
| Literature: Biological and Pharmaceutical Bulletin, , vol. 20, # 8 p. 869 - 873 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Cilazaprilate |
| Ro 31-3113 |
| Cilazaprilatum |
| Cilazaprilat |