2-chloro-1-ethoxy-7-phenylcyclohepta-1,3,5-triene
Modify Date: 2025-11-02 09:02:05
2-chloro-1-ethoxy-7-phenylcyclohepta-1,3,5-triene structure
|
Common Name | 2-chloro-1-ethoxy-7-phenylcyclohepta-1,3,5-triene | ||
|---|---|---|---|---|
| CAS Number | 90127-97-2 | Molecular Weight | 246.73200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-1-ethoxy-7-phenylcyclohepta-1,3,5-triene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15ClO |
|---|---|
| Molecular Weight | 246.73200 |
| Exact Mass | 246.08100 |
| PSA | 9.23000 |
| LogP | 4.38310 |
| InChIKey | ZYIAHIGNDMBDSO-UHFFFAOYSA-N |
| SMILES | CCOC1=C(Cl)C=CC=CC1c1ccccc1 |
|
~%
2-chloro-1-etho... CAS#:90127-97-2 |
| Literature: Cavazza, Marino; Morganti, Gioia; Guerriero, Antonio; Pietra, Francesco Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 2 p. 199 - 202 |
| 2-chloro-1-ethoxy-7-phenylcycloheptatriene |
| 1,3,5-Cycloheptatriene,2-chloro-1-ethoxy-7-phenyl |