tert-butyl 3-[(3-methoxycarbonylphenyl)methyl]-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate structure
|
Common Name | tert-butyl 3-[(3-methoxycarbonylphenyl)methyl]-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 900503-44-8 | Molecular Weight | 357.44300 | |
| Density | 1.158g/cm3 | Boiling Point | 474.695ºC at 760 mmHg | |
| Molecular Formula | C21H27NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.887ºC | |
| Name | tert-butyl 3-[(3-methoxycarbonylphenyl)methyl]-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate |
|---|
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 474.695ºC at 760 mmHg |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.44300 |
| Flash Point | 240.887ºC |
| Exact Mass | 357.19400 |
| PSA | 55.84000 |
| LogP | 4.05180 |
| Index of Refraction | 1.556 |
| InChIKey | RFBXUSCSUYDCRP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(CC2=CC3CCC(C2)N3C(=O)OC(C)(C)C)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |