tert-butyl 3-(4-chloro-2-methoxycarbonylphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate
Modify Date: 2025-11-30 08:48:23
![tert-butyl 3-(4-chloro-2-methoxycarbonylphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate Structure](https://image.chemsrc.com/caspic/013/900503-40-4.png)
tert-butyl 3-(4-chloro-2-methoxycarbonylphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate structure
|
Common Name | tert-butyl 3-(4-chloro-2-methoxycarbonylphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 900503-40-4 | Molecular Weight | 377.86200 | |
| Density | 1.233g/cm3 | Boiling Point | 487.731ºC at 760 mmHg | |
| Molecular Formula | C20H24ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.771ºC | |
| Name | tert-butyl 3-(4-chloro-2-methoxycarbonylphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate |
|---|
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 487.731ºC at 760 mmHg |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.86200 |
| Flash Point | 248.771ºC |
| Exact Mass | 377.13900 |
| PSA | 55.84000 |
| LogP | 4.61970 |
| Index of Refraction | 1.562 |
| InChIKey | UECSFVRIQLMNAV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)ccc1C1=CC2CCC(C1)N2C(=O)OC(C)(C)C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |