tert-butyl 3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate
Modify Date: 2025-09-25 10:21:00
![tert-butyl 3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate Structure](https://image.chemsrc.com/caspic/454/900503-37-9.png)
tert-butyl 3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate structure
|
Common Name | tert-butyl 3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 900503-37-9 | Molecular Weight | 315.40700 | |
| Density | 1.124g/cm3 | Boiling Point | 426.699ºC at 760 mmHg | |
| Molecular Formula | C19H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.86ºC | |
| Name | tert-butyl 3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate |
|---|
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 426.699ºC at 760 mmHg |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.40700 |
| Flash Point | 211.86ºC |
| Exact Mass | 315.18300 |
| PSA | 38.77000 |
| LogP | 4.18830 |
| Index of Refraction | 1.55 |
| InChIKey | RUTFZFJZTIEYAO-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=CC3CCC(C2)N3C(=O)OC(C)(C)C)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |