5,6-dimethyl-3-oxo-4H-pyrazine-2-carboxamide structure
|
Common Name | 5,6-dimethyl-3-oxo-4H-pyrazine-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 90000-71-8 | Molecular Weight | 167.16500 | |
| Density | 1.44g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.16500 |
| Exact Mass | 167.06900 |
| PSA | 88.84000 |
| LogP | 0.18590 |
| Index of Refraction | 1.638 |
| InChIKey | NOYIEGLEXWYCCT-UHFFFAOYSA-N |
| SMILES | Cc1nc(C(N)=O)c(=O)[nH]c1C |
| HS Code | 2934999090 |
|---|
|
~%
5,6-dimethyl-3-... CAS#:90000-71-8 |
| Literature: Jones Journal of the American Chemical Society, 1949 , vol. 71, p. 78,79, 80 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6-dimethyl-3-oxo-3,4-dihydropyrazine-2-carboxamide |
| 5,6-dimethyl-3-oxo-3,4-dihydro-pyrazine-2-carboxylic acid amide |
| 5,6-Dimethyl-3-oxo-3,4-dihydro-pyrazin-2-carbonsaeure-amid |