Benzoic acid, 6-amino-2-methyl-3-nitro- (9CI)
Modify Date: 2025-08-25 19:45:14
Benzoic acid, 6-amino-2-methyl-3-nitro- (9CI) structure
|
Common Name | Benzoic acid, 6-amino-2-methyl-3-nitro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 89977-13-9 | Molecular Weight | 196.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-amino-2-methyl-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8N2O4 |
|---|---|
| Molecular Weight | 196.16000 |
| Exact Mass | 196.04800 |
| PSA | 109.14000 |
| LogP | 2.28800 |
| InChIKey | MLRJGGLSAKYLRT-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])ccc(N)c1C(=O)O |
| HS Code | 2922499990 |
|---|
|
~48%
Benzoic acid, 6... CAS#:89977-13-9 |
| Literature: SRI International Patent: US5428021 A1, 1995 ; US 5428021 A |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 5-nitro-6-methyl-2-aminobenzoic acid |
| 3-Nitro-6-amino-2-methyl-benzoesaeure |
| 6-AMINO-2-METHYL-3-NITRO-BENZOIC ACID |
| 2-methyl-3-nitro-6-aminobenzoic acid |
| Benzoic acid,6-amino-2-methyl-3-nitro |