4'-N-BUTYL-4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)BUTYROPHENONE structure
|
Common Name | 4'-N-BUTYL-4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)BUTYROPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898787-25-2 | Molecular Weight | 318.45000 | |
| Density | 0.986g/cm3 | Boiling Point | 432.7ºC at 760 mmHg | |
| Molecular Formula | C20H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.3ºC | |
| Name | 1-(4-butylphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.986g/cm3 |
|---|---|
| Boiling Point | 432.7ºC at 760 mmHg |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.45000 |
| Flash Point | 207.3ºC |
| Exact Mass | 318.21900 |
| PSA | 35.53000 |
| LogP | 4.78130 |
| Index of Refraction | 1.49 |
| InChIKey | GPPLJGGOIPXIIG-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(C(=O)CCCC2OCC(C)(C)CO2)cc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4'-n-butyl-4-(5,5-dimethyl-1,3-dioxan-2-yl)butyrophenone |