2'-BROMO-5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)VALEROPHENONE structure
|
Common Name | 2'-BROMO-5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)VALEROPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898785-76-7 | Molecular Weight | 355.26700 | |
| Density | 1.226g/cm3 | Boiling Point | 424ºC at 760 mmHg | |
| Molecular Formula | C17H23BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.3ºC | |
| Name | 1-(2-bromophenyl)-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-1-one |
|---|
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 424ºC at 760 mmHg |
| Molecular Formula | C17H23BrO3 |
| Molecular Weight | 355.26700 |
| Flash Point | 210.3ºC |
| Exact Mass | 354.08300 |
| PSA | 35.53000 |
| LogP | 4.59130 |
| Index of Refraction | 1.511 |
| InChIKey | KPZZKXOUXDGWRY-UHFFFAOYSA-N |
| SMILES | CC1(C)COC(CCCCC(=O)c2ccccc2Br)OC1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |