5-(6-METHOXY-3-PYRIDYL)-5-OXOVALERIC ACID structure
|
Common Name | 5-(6-METHOXY-3-PYRIDYL)-5-OXOVALERIC ACID | ||
|---|---|---|---|---|
| CAS Number | 898784-58-2 | Molecular Weight | 223.22500 | |
| Density | 1.224g/cm3 | Boiling Point | 455.9ºC at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.5ºC | |
| Name | 5-(6-methoxypyridin-3-yl)-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 455.9ºC at 760 mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 229.5ºC |
| Exact Mass | 223.08400 |
| PSA | 76.49000 |
| LogP | 1.52780 |
| Index of Refraction | 1.532 |
| InChIKey | JITCYTVJGKKRSI-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCCC(=O)O)cn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(6-Methoxypyridin-3-yl)-5-oxovaleric acid |