2-(2,5-DIMETHYLBENZOYL)PYRIDINE structure
|
Common Name | 2-(2,5-DIMETHYLBENZOYL)PYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 898780-48-8 | Molecular Weight | 211.25900 | |
| Density | 1.092g/cm3 | Boiling Point | 335.7ºC at 760 mmHg | |
| Molecular Formula | C14H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.8ºC | |
| Name | (2,5-dimethylphenyl)-pyridin-2-ylmethanone |
|---|
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 335.7ºC at 760 mmHg |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.25900 |
| Flash Point | 164.8ºC |
| Exact Mass | 211.10000 |
| PSA | 29.96000 |
| LogP | 2.92940 |
| Index of Refraction | 1.573 |
| InChIKey | UCRAXCCFLOBKAZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(C(=O)c2ccccn2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |