8-(2-bromophenyl)-8-oxooctanoic acid structure
|
Common Name | 8-(2-bromophenyl)-8-oxooctanoic acid | ||
|---|---|---|---|---|
| CAS Number | 898765-30-5 | Molecular Weight | 313.18700 | |
| Density | 1.356g/cm3 | Boiling Point | 456.1ºC at 760 mmHg | |
| Molecular Formula | C14H17BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.6ºC | |
| Name | 8-(2-bromophenyl)-8-oxooctanoic acid |
|---|
| Density | 1.356g/cm3 |
|---|---|
| Boiling Point | 456.1ºC at 760 mmHg |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.18700 |
| Flash Point | 229.6ºC |
| Exact Mass | 312.03600 |
| PSA | 54.37000 |
| LogP | 4.05700 |
| Index of Refraction | 1.548 |
| InChIKey | JXXGZGHLPJHEDB-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCC(=O)c1ccccc1Br |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |