4'-(1,3-DIOXOLAN-2-YL)-2-METHOXYBENZOPHENONE structure
|
Common Name | 4'-(1,3-DIOXOLAN-2-YL)-2-METHOXYBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898759-86-9 | Molecular Weight | 284.30700 | |
| Density | 1.199g/cm3 | Boiling Point | 470.3ºC at 760 mmHg | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(1,3-dioxolan-2-yl)phenyl]-(2-methoxyphenyl)methanone |
|---|
| Density | 1.199g/cm3 |
|---|---|
| Boiling Point | 470.3ºC at 760 mmHg |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.30700 |
| Exact Mass | 284.10500 |
| PSA | 44.76000 |
| LogP | 2.97160 |
| Index of Refraction | 1.571 |
| InChIKey | QWKBBDDAKFUSNW-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(=O)c1ccc(C2OCCO2)cc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |