Ethyl 7-(4-methoxy-3-nitrophenyl)-7-oxoheptanoate
Modify Date: 2025-09-04 18:06:56
Ethyl 7-(4-methoxy-3-nitrophenyl)-7-oxoheptanoate structure
|
Common Name | Ethyl 7-(4-methoxy-3-nitrophenyl)-7-oxoheptanoate | ||
|---|---|---|---|---|
| CAS Number | 898758-95-7 | Molecular Weight | 323.34100 | |
| Density | 1.172g/cm3 | Boiling Point | 450.1ºC at 760 mmHg | |
| Molecular Formula | C16H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.7ºC | |
| Name | Ethyl 7-(4-methoxy-3-nitrophenyl)-7-oxoheptanoate |
|---|
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 450.1ºC at 760 mmHg |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.34100 |
| Flash Point | 175.7ºC |
| Exact Mass | 323.13700 |
| PSA | 98.42000 |
| LogP | 3.82290 |
| Index of Refraction | 1.518 |
| InChIKey | KBPZCNKTTQSXIB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCC(=O)c1ccc(OC)c([N+](=O)[O-])c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |