ethyl 6-(2,3-difluorophenyl)-6-oxohexanoate
Modify Date: 2025-09-12 10:46:35
ethyl 6-(2,3-difluorophenyl)-6-oxohexanoate structure
|
Common Name | ethyl 6-(2,3-difluorophenyl)-6-oxohexanoate | ||
|---|---|---|---|---|
| CAS Number | 898753-00-9 | Molecular Weight | 270.27200 | |
| Density | 1.165g/cm3 | Boiling Point | 347.3ºC at 760 mmHg | |
| Molecular Formula | C14H16F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.4ºC | |
| Name | ethyl 6-(2,3-difluorophenyl)-6-oxohexanoate |
|---|
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 347.3ºC at 760 mmHg |
| Molecular Formula | C14H16F2O3 |
| Molecular Weight | 270.27200 |
| Flash Point | 158.4ºC |
| Exact Mass | 270.10700 |
| PSA | 43.37000 |
| LogP | 3.27100 |
| Index of Refraction | 1.479 |
| InChIKey | YXFOWOQINJXVJP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCC(=O)c1cccc(F)c1F |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |