1-(2,5-dimethoxyphenyl)-2-(dimethylamino)ethanone structure
|
Common Name | 1-(2,5-dimethoxyphenyl)-2-(dimethylamino)ethanone | ||
|---|---|---|---|---|
| CAS Number | 89864-08-4 | Molecular Weight | 223.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,5-dimethoxyphenyl)-2-(dimethylamino)ethanone |
|---|
| Molecular Formula | C12H17NO3 |
|---|---|
| Molecular Weight | 223.26800 |
| Exact Mass | 223.12100 |
| PSA | 38.77000 |
| LogP | 1.44810 |
| InChIKey | ZSIRPQCIOCRLSM-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C(=O)CN(C)C)c1 |
|
~%
1-(2,5-dimethox... CAS#:89864-08-4 |
| Literature: Ciba-Geigy Corporation Patent: US4818765 A1, 1989 ; |
|
~%
1-(2,5-dimethox... CAS#:89864-08-4 |
| Literature: Baltzly; Buck Journal of the American Chemical Society, 1940 , vol. 62, p. 164,166 Journal of the American Chemical Society, 1942 , vol. 64, p. 3040 |