6-but-3-enyl-1-methyl-3,4-dihydro-2H-pyridine,perchloric acid
Modify Date: 2025-10-09 14:26:23
6-but-3-enyl-1-methyl-3,4-dihydro-2H-pyridine,perchloric acid structure
|
Common Name | 6-but-3-enyl-1-methyl-3,4-dihydro-2H-pyridine,perchloric acid | ||
|---|---|---|---|---|
| CAS Number | 89862-90-8 | Molecular Weight | 251.70700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-but-3-enyl-1-methyl-3,4-dihydro-2H-pyridine,perchloric acid |
|---|
| Molecular Formula | C10H18ClNO4 |
|---|---|
| Molecular Weight | 251.70700 |
| Exact Mass | 251.09200 |
| PSA | 74.68000 |
| LogP | 2.65630 |
| InChIKey | ZJLSATFJNOQSLZ-UHFFFAOYSA-N |
| SMILES | C=CCCC1=CCCCN1C.[O-][Cl+3]([O-])([O-])O |
|
~%
6-but-3-enyl-1-... CAS#:89862-90-8 |
| Literature: Cervinka, Otakar; Fabryova, Anna; Josef, Jan; Sermek, Vladimir; Smrckova, Svatava Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 12 p. 3407 - 3412 |
|
~%
6-but-3-enyl-1-... CAS#:89862-90-8 |
| Literature: Cervinka, Otakar; Fabryova, Anna; Josef, Jan; Sermek, Vladimir; Smrckova, Svatava Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 12 p. 3407 - 3412 |
