2-methyl-2-nitro-N-propan-2-yl-propan-1-amine
Modify Date: 2025-08-25 18:46:33
2-methyl-2-nitro-N-propan-2-yl-propan-1-amine structure
|
Common Name | 2-methyl-2-nitro-N-propan-2-yl-propan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 89850-87-3 | Molecular Weight | 160.21400 | |
| Density | 0.964g/cm3 | Boiling Point | 220.7ºC at 760 mmHg | |
| Molecular Formula | C7H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.3ºC | |
| Name | N-(2-nitrofluorenylidene)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 0.964g/cm3 |
|---|---|
| Boiling Point | 220.7ºC at 760 mmHg |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.21400 |
| Flash Point | 87.3ºC |
| Exact Mass | 160.12100 |
| PSA | 57.85000 |
| LogP | 1.95380 |
| Index of Refraction | 1.442 |
| InChIKey | RJWPORRWKYCXJF-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(C)(C)[N+](=O)[O-] |
|
~%
2-methyl-2-nitr... CAS#:89850-87-3 |
| Literature: The BF Goodrich Company Patent: US4698446 A1, 1987 ; |
|
~%
2-methyl-2-nitr... CAS#:89850-87-3 |
| Literature: Senkus Journal of the American Chemical Society, 1946 , vol. 68, p. 11 |
|
~%
Detail
|
| Literature: Senkus Journal of the American Chemical Society, 1946 , vol. 68, p. 11 |
CAS#:5448-29-3| N-<2-Nitro-fluorenyl-(9)>-trifluoracetamid |
| 2-nitro-9-(N-phenyl)-iminofluorene |
| N-(2-nitroisobutyl)isopropylamine |
| 4-methyl-N-(2-nitrobenzylidene)aniline |
| (2-nitro-fluoren-9-ylidene)-phenyl-amine |
| (2-Nitro-fluoren-9-yliden)-phenyl-amin |
| (2-Nitro-benzal)-p-toluidin |
| N-(2-nitro-benzylidene)-p-toluidine |
| 2-Nitro-fluorenon-anil |
| (2-Nitro-benzaldehyd)-p-tolylimid |
| N-(2-Nitro-benzyliden)-p-toluidin |