3-nitro-N,N-dipropylbenzenesulfonamide structure
|
Common Name | 3-nitro-N,N-dipropylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 89840-76-6 | Molecular Weight | 286.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-nitro-N,N-dipropylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18N2O4S |
|---|---|
| Molecular Weight | 286.34700 |
| Exact Mass | 286.09900 |
| PSA | 91.58000 |
| LogP | 4.00950 |
| InChIKey | VDXRCDGJYBNCSP-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
|
~%
3-nitro-N,N-dip... CAS#:89840-76-6 |
| Literature: Campbell; Campbell; Salm Proceedings of the Indiana Academy of Science, 1948 , vol. 57, p. 100 Chem.Abstr., 1949 , p. 4630 |
| Benzenesulfonamide,3-nitro-N,N-dipropyl |
| F1058-0139 |
| 3-nitro-benzenesulfonic acid dipropylamide |
| 3-Nitro-benzolsulfonsaeure-dipropylamid |