Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate
Modify Date: 2026-09-27 17:36:29
Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate structure
|
Common Name | Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate | ||
|---|---|---|---|---|
| CAS Number | 89778-40-5 | Molecular Weight | 338.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19NaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H19NaO2 |
|---|---|
| Molecular Weight | 338.4 |
| InChIKey | XPGJYCQDGCQMRR-QUABFQRHSA-M |
| SMILES | [Na+].[O-]c1ccc(C(=C(CCO)c2ccccc2)c2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 89778-40-5? |
| A: Chinese name of 89778-40-5 is 89778-40-5. |
| Q: What is the molecular formula of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate? |
| A: Molecular formula of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate is C22H19NaO2. |
| Q: What is the SMILES notation of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate? |
| A: SMILES notation of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate is [Na+].[O-]c1ccc(C(=C(CCO)c2ccccc2)c2ccccc2)cc1. |
| Q: What is the molecular weight of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate? |
| A: Molecular weight of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate is 338.4. |
| Q: What is the InChIKey of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate? |
| A: InChIKey of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate is XPGJYCQDGCQMRR-QUABFQRHSA-M. |
| Q: What is the English name of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate? |
| A: The English name of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate is Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate. |
| Q: What is the CAS number of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate? |
| A: CAS number of Sodium (E)-4-(4-hydroxy-1,2-diphenylbut-1-en-1-yl)phenolate is 89778-40-5. |