1-bromo-4-[4-[4-(3-methylbutyl)phenyl]phenyl]benzene
Modify Date: 2025-09-20 16:48:26
![1-bromo-4-[4-[4-(3-methylbutyl)phenyl]phenyl]benzene Structure](https://image.chemsrc.com/caspic/199/89752-74-9.png)
1-bromo-4-[4-[4-(3-methylbutyl)phenyl]phenyl]benzene structure
|
Common Name | 1-bromo-4-[4-[4-(3-methylbutyl)phenyl]phenyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 89752-74-9 | Molecular Weight | 379.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H23Br | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-bromo-4-[4-[4-(3-methylbutyl)phenyl]phenyl]benzene |
|---|
| Molecular Formula | C23H23Br |
|---|---|
| Molecular Weight | 379.33300 |
| Exact Mass | 378.09800 |
| LogP | 7.37170 |
| InChIKey | IBZGZUZAAVFGJF-UHFFFAOYSA-N |
| SMILES | CC(C)CCc1ccc(-c2ccc(-c3ccc(Br)cc3)cc2)cc1 |
|
~76%
1-bromo-4-[4-[4... CAS#:89752-74-9 |
| Literature: Gray; Kelly Molecular crystals and liquid crystals, 1984 , vol. 104, # 3-4 p. 335 - 345 |
|
~%
1-bromo-4-[4-[4... CAS#:89752-74-9 |
| Literature: Gray; Kelly Molecular crystals and liquid crystals, 1984 , vol. 104, # 3-4 p. 335 - 345 |
|
~%
1-bromo-4-[4-[4... CAS#:89752-74-9 |
| Literature: Gray; Kelly Molecular crystals and liquid crystals, 1984 , vol. 104, # 3-4 p. 335 - 345 |
|
~%
1-bromo-4-[4-[4... CAS#:89752-74-9 |
| Literature: Gray; Kelly Molecular crystals and liquid crystals, 1984 , vol. 104, # 3-4 p. 335 - 345 |
![3-methyl-1-[4-(4-phenylphenyl)phenyl]butan-1-one structure](https://image.chemsrc.com/caspic/068/89752-82-9.png)
