6-Amino-3-phenyl-1,2,4-triazine-5(2H)-thione structure
|
Common Name | 6-Amino-3-phenyl-1,2,4-triazine-5(2H)-thione | ||
|---|---|---|---|---|
| CAS Number | 89730-60-9 | Molecular Weight | 204.25200 | |
| Density | 1.45g/cm3 | Boiling Point | 344.8ºC at 760 mmHg | |
| Molecular Formula | C9H8N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.3ºC | |
| Name | 6-amino-3-phenyl-2H-1,2,4-triazine-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 344.8ºC at 760 mmHg |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.25200 |
| Flash Point | 162.3ºC |
| Exact Mass | 204.04700 |
| PSA | 99.68000 |
| LogP | 2.36460 |
| Index of Refraction | 1.754 |
| InChIKey | YJHHJDAXYQYVPU-UHFFFAOYSA-N |
| SMILES | Nc1n[nH]c(-c2ccccc2)nc1=S |
| HS Code | 2933699090 |
|---|
|
~78%
6-Amino-3-pheny... CAS#:89730-60-9 |
| Literature: Neunhoeffer, Hans; Hammann, Heinz Liebigs Annalen der Chemie, 1984 , # 2 p. 283 - 295 |
|
~%
6-Amino-3-pheny... CAS#:89730-60-9 |
| Literature: Neunhoeffer, Hans; Hammann, Heinz Liebigs Annalen der Chemie, 1984 , # 2 p. 283 - 295 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 6-Amino-3-phenyl-1,2,4-triazin-5(2H)-thion |
| 6-Amino-5-thioxo-3-phenyl-2,5-dihydro-1,2,4-triazin |
| 6-Amino-3-phenyl-1,2,4-triazine-5(2H)-thione |
| 1,2,4-Triazine-5(2H)-thione,6-amino-3-phenyl |