Dipropan-2-yl undecanedioate
Modify Date: 2025-08-25 09:31:59
Dipropan-2-yl undecanedioate structure
|
Common Name | Dipropan-2-yl undecanedioate | ||
|---|---|---|---|---|
| CAS Number | 89705-67-9 | Molecular Weight | 300.434 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 321.3±10.0 °C at 760 mmHg | |
| Molecular Formula | C17H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.9±17.4 °C | |
| Name | dipropan-2-yl undecanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 321.3±10.0 °C at 760 mmHg |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.434 |
| Flash Point | 140.9±17.4 °C |
| Exact Mass | 300.230072 |
| PSA | 52.60000 |
| LogP | 5.07 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.445 |
| InChIKey | GCRTUVFYDATJEY-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CCCCCCCCCC(=O)OC(C)C |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 289-517-2 |
| Diisopropyl undecanedioate |
| Undecanedioic acid, bis(1-methylethyl) ester |