(5-oxo-2,3-dihydro-1-benzothiepin-4-ylidene)methyl benzoate
Modify Date: 2025-08-25 10:16:49
(5-oxo-2,3-dihydro-1-benzothiepin-4-ylidene)methyl benzoate structure
|
Common Name | (5-oxo-2,3-dihydro-1-benzothiepin-4-ylidene)methyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 89650-00-0 | Molecular Weight | 310.36700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-oxo-2,3-dihydro-1-benzothiepin-4-ylidene)methyl benzoate |
|---|
| Molecular Formula | C18H14O3S |
|---|---|
| Molecular Weight | 310.36700 |
| Exact Mass | 310.06600 |
| PSA | 68.67000 |
| LogP | 4.10600 |
| InChIKey | CPVWXKWSHQGEDJ-UHFFFAOYSA-N |
| SMILES | O=C(OC=C1CCSc2ccccc2C1=O)c1ccccc1 |
|
~76%
(5-oxo-2,3-dihy... CAS#:89650-00-0 |
| Literature: Bhattacharya, Sudin; Mandal, Asok N.; Chaudhuri, Swadesh R. Ray; Chatterjee, Amareshwar Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 1 p. 5 - 13 |
|
~%
(5-oxo-2,3-dihy... CAS#:89650-00-0 |
| Literature: Bhattacharya, Sudin; Mandal, Asok N.; Chaudhuri, Swadesh R. Ray; Chatterjee, Amareshwar Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 1 p. 5 - 13 |
