4-chloro-7-(trifluoromethyl)quinoline-3-carboxylic acid
Modify Date: 2025-08-26 18:35:22
4-chloro-7-(trifluoromethyl)quinoline-3-carboxylic acid structure
|
Common Name | 4-chloro-7-(trifluoromethyl)quinoline-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 89524-63-0 | Molecular Weight | 275.61100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H5ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-7-(trifluoromethyl)quinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H5ClF3NO2 |
|---|---|
| Molecular Weight | 275.61100 |
| Exact Mass | 274.99600 |
| PSA | 50.19000 |
| LogP | 3.60520 |
| InChIKey | PACCRSUMCGBTBO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cnc2cc(C(F)(F)F)ccc2c1Cl |
| HS Code | 2933499090 |
|---|
|
~%
4-chloro-7-(tri... CAS#:89524-63-0 |
| Literature: Cale Jr.; Gero; Walker; Lo; Welstead Jr.; Jaques; Johnson; Leonard; Nolan Journal of Medicinal Chemistry, 1989 , vol. 32, # 9 p. 2178 - 2199 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-7-trifluoromethyl-quinoline-3-carboxylic acid |