1-(2-acetylphenothiazin-10-yl)-2-[(2,4-dichlorophenyl)methylamino]ethanone structure
|
Common Name | 1-(2-acetylphenothiazin-10-yl)-2-[(2,4-dichlorophenyl)methylamino]ethanone | ||
|---|---|---|---|---|
| CAS Number | 89516-32-5 | Molecular Weight | 457.37200 | |
| Density | 1.388g/cm3 | Boiling Point | 696ºC at 760 mmHg | |
| Molecular Formula | C23H18Cl2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 374.8ºC | |
| Name | 1-(2-acetylphenothiazin-10-yl)-2-[(2,4-dichlorophenyl)methylamino]ethanone |
|---|
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 696ºC at 760 mmHg |
| Molecular Formula | C23H18Cl2N2O2S |
| Molecular Weight | 457.37200 |
| Flash Point | 374.8ºC |
| Exact Mass | 456.04700 |
| PSA | 74.71000 |
| LogP | 6.57100 |
| Index of Refraction | 1.667 |
| InChIKey | LNABEMVFKGRFGJ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)N(C(=O)CNCc1ccc(Cl)cc1Cl)c1ccccc1S2 |
|
~55%
1-(2-acetylphen... CAS#:89516-32-5 |
| Literature: Kumar, P.; Nath, C.; Agarwal, Jagdish C.; Bhargava, K. P.; Shanker, K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 9 p. 952 - 954 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |