2-hydroxy-2-(3-methylbut-2-enyl)-3-nitronaphthalen-1-one structure
|
Common Name | 2-hydroxy-2-(3-methylbut-2-enyl)-3-nitronaphthalen-1-one | ||
|---|---|---|---|---|
| CAS Number | 89510-50-9 | Molecular Weight | 273.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-2-(3-methylbut-2-enyl)-3-nitronaphthalen-1-one |
|---|
| Molecular Formula | C15H15NO4 |
|---|---|
| Molecular Weight | 273.28400 |
| Exact Mass | 273.10000 |
| PSA | 83.12000 |
| LogP | 3.11110 |
| InChIKey | GEFSOFPGEPDYMO-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC1(O)C(=O)c2ccccc2C=C1[N+](=O)[O-] |
|
~45%
2-hydroxy-2-(3-... CAS#:89510-50-9 |
| Literature: Takuwa, Akio; Naruta, Yoshinori; Soga, Osamu; Maruyama, Kazuhiro Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1857 - 1864 |
|
~45%
2-hydroxy-2-(3-... CAS#:89510-50-9 |
| Literature: Takuwa, Akio; Naruta, Yoshinori; Soga, Osamu; Maruyama, Kazuhiro Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1857 - 1864 |