CHEMBRDG-BB 7959273
Modify Date: 2025-09-22 15:20:18
CHEMBRDG-BB 7959273 structure
|
Common Name | CHEMBRDG-BB 7959273 | ||
|---|---|---|---|---|
| CAS Number | 895042-86-1 | Molecular Weight | 203.24000 | |
| Density | 1.211g/cm3 | Boiling Point | 420ºC at 760 mmHg | |
| Molecular Formula | C11H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.8ºC | |
| Name | 5-(Methoxymethyl)-4-phenyl-1H-pyrazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 420ºC at 760 mmHg |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24000 |
| Flash Point | 207.8ºC |
| Exact Mass | 203.10600 |
| PSA | 64.66000 |
| LogP | 1.73540 |
| Index of Refraction | 1.619 |
| InChIKey | REIKKMUTPQYVNL-UHFFFAOYSA-N |
| SMILES | COCc1[nH]nc(N)c1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(methoxymethyl)-4-phenyl-1H-pyrazol-5-amine |
| 3-(methoxymethyl)-4-phenylpyrazole-5-ylamine |
| 5-Methoxymethyl-4-phenyl-2H-pyrazol-3-ylamine |