1,7-Phenanthroline-4,10-diol,2,8-dimethyl- structure
|
Common Name | 1,7-Phenanthroline-4,10-diol,2,8-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 89481-38-9 | Molecular Weight | 240.25700 | |
| Density | 1.259g/cm3 | Boiling Point | 427.7ºC at 760mmHg | |
| Molecular Formula | C14H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.1ºC | |
| Name | 2,8-dimethyl-1,7-dihydro-1,7-phenanthroline-4,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 427.7ºC at 760mmHg |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.25700 |
| Flash Point | 177.1ºC |
| Exact Mass | 240.09000 |
| PSA | 66.24000 |
| LogP | 2.81100 |
| Index of Refraction | 1.61 |
| InChIKey | FEGCUBWCNYCUCH-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c2c(ccc3c(=O)cc(C)[nH]c32)[nH]1 |
|
~%
1,7-Phenanthrol... CAS#:89481-38-9 |
| Literature: Bangdiwala; Desai Journal of the Indian Chemical Society, 1954 , vol. 31, p. 927 |
|
~%
1,7-Phenanthrol... CAS#:89481-38-9 |
| Literature: Bangdiwala; Desai Journal of the Indian Chemical Society, 1954 , vol. 31, p. 927 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,8-dimethyl-1H,7H-[1,7]phenanthroline-4,10-dione |
| 1,7-Phenanthroline-4,10-diol,2,8-dimethyl |
| 2,8-Dimethyl-1H,7H-[1,7]phenanthrolin-4,10-dion |