3-methyl-5-(3-methyl-5-phenyl-1,2-oxazol-4-yl)-1,4,2-dioxazole structure
|
Common Name | 3-methyl-5-(3-methyl-5-phenyl-1,2-oxazol-4-yl)-1,4,2-dioxazole | ||
|---|---|---|---|---|
| CAS Number | 89479-69-6 | Molecular Weight | 244.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-5-(3-methyl-5-phenyl-1,2-oxazol-4-yl)-1,4,2-dioxazole |
|---|
| Molecular Formula | C13H12N2O3 |
|---|---|
| Molecular Weight | 244.24600 |
| Exact Mass | 244.08500 |
| PSA | 56.85000 |
| LogP | 2.46440 |
| InChIKey | NMYINEBJCHQPRQ-UHFFFAOYSA-N |
| SMILES | CC1=NOC(c2c(C)noc2-c2ccccc2)O1 |
|
~70%
3-methyl-5-(3-m... CAS#:89479-69-6 |
| Literature: De Sarlo, Francesco; Guarna, Antonio; Brandi, Alberto Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1505 - 1507 |
|
~%
3-methyl-5-(3-m... CAS#:89479-69-6 |
| Literature: De Sarlo, Francesco; Guarna, Antonio; Brandi, Alberto Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1505 - 1507 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |