Naphtho[2,3-c]thiophene-4,9-dione, 5-[[2-(dimethylamino)ethyl]methylamino]- structure
|
Common Name | Naphtho[2,3-c]thiophene-4,9-dione, 5-[[2-(dimethylamino)ethyl]methylamino]- | ||
|---|---|---|---|---|
| CAS Number | 89479-41-4 | Molecular Weight | 314.40200 | |
| Density | 1.292g/cm3 | Boiling Point | 488.4ºC at 760 mmHg | |
| Molecular Formula | C17H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.1ºC | |
| Name | 5-[2-(dimethylamino)ethyl-methylamino]benzo[f][2]benzothiole-4,9-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 488.4ºC at 760 mmHg |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.40200 |
| Flash Point | 249.1ºC |
| Exact Mass | 314.10900 |
| PSA | 68.86000 |
| LogP | 2.52130 |
| Index of Refraction | 1.652 |
| InChIKey | DLVLJLSBAHBMGL-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(C)c1cccc2c1C(=O)c1cscc1C2=O |
|
~%
Naphtho[2,3-c]t... CAS#:89479-41-4 |
| Literature: Marecki, Paul E.; Butke, Gregory P. Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1497 - 1500 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-<2-(dimethylamino)ethyl methylamino>-4,9-dihydronaphtho<2,3-c>thiophene-4,9-dione |
| 5-[2-dimethylaminoethyl(methyl)amino]benzo[f][2]benzothiole-4,9-dione |