9-Amino-N-(2-((2-hydroxyethyl)amino)ethyl)-4-acridinecarboxamide structure
|
Common Name | 9-Amino-N-(2-((2-hydroxyethyl)amino)ethyl)-4-acridinecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 89459-30-3 | Molecular Weight | 324.37700 | |
| Density | 1.3g/cm3 | Boiling Point | 708ºC at 760 mmHg | |
| Molecular Formula | C18H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 382ºC | |
| Name | 9-amino-N-[2-(2-hydroxyethylamino)ethyl]acridine-4-carboxamide |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 708ºC at 760 mmHg |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.37700 |
| Flash Point | 382ºC |
| Exact Mass | 324.15900 |
| PSA | 103.76000 |
| LogP | 2.82880 |
| Index of Refraction | 1.705 |
| InChIKey | LGDNJXAZBBKQQZ-UHFFFAOYSA-N |
| SMILES | Nc1c2ccccc2nc2c(C(=O)NCCNCCO)cccc12 |
|
~%
9-Amino-N-(2-((... CAS#:89459-30-3 |
| Literature: Atwell; Cain; Baguley; Finlay; Denny Journal of Medicinal Chemistry, 1984 , vol. 27, # 11 p. 1481 - 1485 |
|
~%
9-Amino-N-(2-((... CAS#:89459-30-3 |
| Literature: Atwell; Cain; Baguley; Finlay; Denny Journal of Medicinal Chemistry, 1984 , vol. 27, # 11 p. 1481 - 1485 |
|
~%
9-Amino-N-(2-((... CAS#:89459-30-3 |
| Literature: Atwell; Cain; Baguley; Finlay; Denny Journal of Medicinal Chemistry, 1984 , vol. 27, # 11 p. 1481 - 1485 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |