5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine structure
|
Common Name | 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 89445-84-1 | Molecular Weight | 281.31300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(8-methoxyquinolin-6-yl)methyl]pyrimidine-2,4-diamine |
|---|
| Molecular Formula | C15H15N5O |
|---|---|
| Molecular Weight | 281.31300 |
| Exact Mass | 281.12800 |
| PSA | 101.40000 |
| LogP | 1.64880 |
| InChIKey | SWFUEQPLVRLTCU-UHFFFAOYSA-N |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc2cccnc12 |
|
~20%
5-[(8-methoxyqu... CAS#:89445-84-1 |
| Literature: Rauckman; Tidwell; Johnson; Roth Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1927 - 1935 |
|
~%
5-[(8-methoxyqu... CAS#:89445-84-1 |
| Literature: Rauckman; Tidwell; Johnson; Roth Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1927 - 1935 |
|
~%
5-[(8-methoxyqu... CAS#:89445-84-1 |
| Literature: Rauckman; Tidwell; Johnson; Roth Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1927 - 1935 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |