CHEMBRDG-BB 9071543
Modify Date: 2025-09-18 04:50:59
CHEMBRDG-BB 9071543 structure
|
Common Name | CHEMBRDG-BB 9071543 | ||
|---|---|---|---|---|
| CAS Number | 894365-26-5 | Molecular Weight | 215.25100 | |
| Density | 1.16g/cm3 | Boiling Point | 420.3ºC at 760 mmHg | |
| Molecular Formula | C12H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208ºC | |
| Name | 2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)benzaldehyde |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 420.3ºC at 760 mmHg |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.25100 |
| Flash Point | 208ºC |
| Exact Mass | 215.10600 |
| PSA | 47.78000 |
| LogP | 1.75570 |
| Index of Refraction | 1.601 |
| InChIKey | BXYIAQSNCWYCCG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(Cn2cncn2)cc1C=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |