iodomethyl-bis[(2,4,6-tritert-butylphenyl)sulfanyl]stannane structure
|
Common Name | iodomethyl-bis[(2,4,6-tritert-butylphenyl)sulfanyl]stannane | ||
|---|---|---|---|---|
| CAS Number | 89412-44-2 | Molecular Weight | 814.60800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H60IS2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | iodomethyl-bis[(2,4,6-tritert-butylphenyl)sulfanyl]stannane |
|---|
| Molecular Formula | C37H60IS2Sn |
|---|---|
| Molecular Weight | 814.60800 |
| Exact Mass | 815.22000 |
| LogP | 11.51720 |
| InChIKey | ACGXBOZZKJKZAC-UHFFFAOYSA-L |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(S[SnH](CI)Sc2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
|
~%
iodomethyl-bis[... CAS#:89412-44-2 |
| Literature: Hitchcock, Peter B.; Lappert, Michael F.; Samways, Barry J.; Weinberg, Erica L. Journal of the Chemical Society, Chemical Communications, 1983 , # 24 p. 1492 - 1494 |