β-D-glucuronide-pNP-carbonate
Modify Date: 2025-08-26 14:15:13
β-D-glucuronide-pNP-carbonate structure
|
Common Name | β-D-glucuronide-pNP-carbonate | ||
|---|---|---|---|---|
| CAS Number | 894095-98-8 | Molecular Weight | 913.83 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H43N3O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of β-D-glucuronide-pNP-carbonateβ-D-glucuronide-pNP-carbonate is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | β-D-glucuronide-pNP-carbonate |
|---|
| Description | β-D-glucuronide-pNP-carbonate is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C45H43N3O18 |
|---|---|
| Molecular Weight | 913.83 |
| InChIKey | DMGQNZOORDYDEZ-LELKPENRSA-N |
| SMILES | COC(=O)C1OC(Oc2ccc(COC(=O)Oc3ccc([N+](=O)[O-])cc3)cc2NC(=O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |