4-nitro-N-pentyl-benzamide structure
|
Common Name | 4-nitro-N-pentyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 89399-20-2 | Molecular Weight | 236.26700 | |
| Density | 1.137g/cm3 | Boiling Point | 414.7ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.6ºC | |
| Name | 4-nitro-N-pentylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 414.7ºC at 760 mmHg |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.26700 |
| Flash Point | 204.6ºC |
| Exact Mass | 236.11600 |
| PSA | 74.92000 |
| LogP | 3.42890 |
| Index of Refraction | 1.538 |
| InChIKey | BEPRYLWKWWVVQA-UHFFFAOYSA-N |
| SMILES | CCCCCNC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~67%
4-nitro-N-penty... CAS#:89399-20-2 |
| Literature: Clark; Wells; Sansom; et al. Journal of Medicinal Chemistry, 1984 , vol. 27, # 6 p. 779 - 782 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-nitro-benzoic acid pentylamide |
| 4-Nitro-benzoesaeure-pentylamid |
| N-n-pentyl-4-nitrobenzamide |