6-[[2-(4-oxopent-2-en-2-ylamino)ethylamino]methylidene]cyclohexa-2,4-dien-1-one
Modify Date: 2025-08-23 07:39:13
![6-[[2-(4-oxopent-2-en-2-ylamino)ethylamino]methylidene]cyclohexa-2,4-dien-1-one Structure](https://image.chemsrc.com/caspic/052/89376-49-8.png)
6-[[2-(4-oxopent-2-en-2-ylamino)ethylamino]methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 6-[[2-(4-oxopent-2-en-2-ylamino)ethylamino]methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 89376-49-8 | Molecular Weight | 246.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[[2-(4-oxopent-2-en-2-ylamino)ethylamino]methylidene]cyclohexa-2,4-dien-1-one |
|---|
| Molecular Formula | C14H18N2O2 |
|---|---|
| Molecular Weight | 246.30500 |
| Exact Mass | 246.13700 |
| PSA | 58.20000 |
| LogP | 2.01920 |
| InChIKey | FYRKWYWDYAQSTQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C=C(C)NCCN=Cc1ccccc1O |
|
~98%
6-[[2-(4-oxopen... CAS#:89376-49-8 |
| Literature: Garcia-Deibe, Ana; Sousa, Antonio; Bermejo, Manuel R.; Rory, Philomena P. Mac; McAuliffe, Charles A.; et al. Journal of the Chemical Society, Chemical Communications, 1991 , # 10 p. 728 - 729 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |