5-[(5-amino-2,2-diethylfuran-3-ylidene)amino]pentan-1-ol structure
|
Common Name | 5-[(5-amino-2,2-diethylfuran-3-ylidene)amino]pentan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 89376-12-5 | Molecular Weight | 240.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(5-amino-2,2-diethylfuran-3-ylidene)amino]pentan-1-ol |
|---|
| Molecular Formula | C13H24N2O2 |
|---|---|
| Molecular Weight | 240.34200 |
| Exact Mass | 240.18400 |
| PSA | 67.84000 |
| LogP | 2.67940 |
| InChIKey | YGNPVLKSDWSLDM-UHFFFAOYSA-N |
| SMILES | CCC1(CC)OC(N)=CC1=NCCCCCO |
|
~89%
5-[(5-amino-2,2... CAS#:89376-12-5 |
| Literature: Landor, Stephen R.; Asobo, P. Forche; Fomum, Z. Tanee; Roberts, Ralph Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 5 p. 1201 - 1204 |
|
~%
5-[(5-amino-2,2... CAS#:89376-12-5 |
| Literature: Landor, Stephen R.; Asobo, P. Forche; Fomum, Z. Tanee; Roberts, Ralph Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 5 p. 1201 - 1204 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |