[3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane
![[3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane Structure](https://image.chemsrc.com/caspic/035/89373-11-5.png)
[3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane structure
|
Common Name | [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 89373-11-5 | Molecular Weight | 330.56000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26OSSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H26OSSi |
|---|---|
| Molecular Weight | 330.56000 |
| Exact Mass | 330.14700 |
| PSA | 36.28000 |
| LogP | 5.99950 |
| InChIKey | XOPJVFLABOFLQI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCC(Cc1ccccc1)S(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[3-(benzenesulf... CAS#:89373-11-5 |
| Literature: Hosomi, Akira; Inaba, Masahiro; Sakurai, Hideki Chemistry Letters, 1983 , p. 1763 - 1766 |
|
~%
[3-(benzenesulf... CAS#:89373-11-5 |
| Literature: Hosomi, Akira; Inaba, Masahiro; Sakurai, Hideki Chemistry Letters, 1983 , p. 1763 - 1766 |
|
~%
[3-(benzenesulf... CAS#:89373-11-5 |
| Literature: Hosomi, Akira; Inaba, Masahiro; Sakurai, Hideki Chemistry Letters, 1983 , p. 1763 - 1766 |
|
~%
[3-(benzenesulf... CAS#:89373-11-5 |
| Literature: Hosomi, Akira; Inaba, Masahiro; Sakurai, Hideki Chemistry Letters, 1983 , p. 1763 - 1766 |
|
~%
[3-(benzenesulf... CAS#:89373-11-5 |
| Literature: Hosomi, Akira; Inaba, Masahiro; Sakurai, Hideki Chemistry Letters, 1983 , p. 1763 - 1766 |
|
~%
[3-(benzenesulf... CAS#:89373-11-5 |
| Literature: Hosomi, Akira; Inaba, Masahiro; Sakurai, Hideki Chemistry Letters, 1983 , p. 1763 - 1766 |
![[[3-(trimethylsilyl)propyl]thio]benzene structure](https://image.chemsrc.com/caspic/232/19185-59-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane? |
| A: Molecular formula of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane is C19H26OSSi. |
| Q: What is the polar surface area (PSA) of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane? |
| A: Polar surface area (PSA) of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane is 36.28000. |
| Q: What is the CAS number of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane? |
| A: CAS number of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane is 89373-11-5. |
| Q: What is the English name of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane? |
| A: The English name of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane is [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane. |
| Q: What is the SMILES notation of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane? |
| A: SMILES notation of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane is C[Si](C)(C)CCC(Cc1ccccc1)S(=O)c1ccccc1. |
| Q: What is the Chinese name of 89373-11-5? |
| A: Chinese name of 89373-11-5 is 89373-11-5. |
| Q: What is the InChIKey of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane? |
| A: InChIKey of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane is XOPJVFLABOFLQI-UHFFFAOYSA-N. |
| Q: What is the LogP of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane? |
| A: LogP of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane is 5.99950. |
| Q: What are the upstream materials of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane? |
| A: Related upstream materials(CAS) of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane: 10545-34-3;3111-52-2;108-98-5;762-72-1;100-44-7;89373-04-6. |
| Q: What is the molecular weight of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane? |
| A: Molecular weight of [3-(benzenesulfinyl)-4-phenylbutyl]-trimethylsilane is 330.56000. |