2,4,8-trichloro-7-methoxyquinoline structure
|
Common Name | 2,4,8-trichloro-7-methoxyquinoline | ||
|---|---|---|---|---|
| CAS Number | 893620-26-3 | Molecular Weight | 262.52000 | |
| Density | 1.486 | Boiling Point | 348.5ºC at 760 mmHg | |
| Molecular Formula | C10H6Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,8-trichloro-7-methoxyquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486 |
|---|---|
| Boiling Point | 348.5ºC at 760 mmHg |
| Molecular Formula | C10H6Cl3NO |
| Molecular Weight | 262.52000 |
| Exact Mass | 260.95100 |
| PSA | 22.12000 |
| LogP | 4.20360 |
| Index of Refraction | 1.638 |
| InChIKey | FYRUHYCICHPKHQ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(Cl)cc(Cl)nc2c1Cl |
| Storage condition | 2-8°C |
| HS Code | 2933499090 |
|---|
|
~75%
2,4,8-trichloro... CAS#:893620-26-3 |
| Literature: IDENIX PHARMACEUTICALS, INC. Patent: US2012/207703 A1, 2012 ; |
|
~73%
2,4,8-trichloro... CAS#:893620-26-3 |
| Literature: IDENIX PHARMACEUTICALS, INC.; PARSY, Christophe Claude; ALEXANDRE, Francois-Rene; LEROY, Frederic; CONVARD, Thierry; SURLERAUX, Dominique Patent: WO2011/17389 A1, 2011 ; Location in patent: Page/Page column 148-149 ; WO 2011/017389 A1 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4,8-tris(chloranyl)-7-methoxy-quinoline |
| Quinoline,2,4,8-trichloro-7-methoxy |
| QUI060 |